C10H19ClF3NO2S — CID 106146106
N-(4-chloro-2,2-dimethylbutyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106146106) has the molecular formula C10H19ClF3NO2S and a molecular weight of 309.78 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106146106 |
| Molecular Formula | C10H19ClF3NO2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(C)(CCCl)CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H19ClF3NO2S/c1-9(2,5-6-11)8-15-18(16,17)7-3-4-10(12,13)14/h15H,3-8H2,1-2H3 |
| InChIKey | LMXSMFMGGFAXAC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|