C11H24ClNO3S — CID 106146162
N-(5-chloro-2,2-dimethylpentyl)-2-ethoxyethanesulfonamide (PubChem CID 106146162) has the molecular formula C11H24ClNO3S and a molecular weight of 285.84 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-ethoxyethanesulfonamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-ethoxyethanesulfonamide |
|---|---|
| PubChem CID | 106146162 |
| Molecular Formula | C11H24ClNO3S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-ethoxyethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)NCC(C)(C)CCCCl |
| InChI | InChI=1S/C11H24ClNO3S/c1-4-16-8-9-17(14,15)13-10-11(2,3)6-5-7-12/h13H,4-10H2,1-3H3 |
| InChIKey | CMXXIUASSNSCMF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|