C4H7BrF3NO4S2 — CID 174191027
3-bromo-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 174191027) has the molecular formula C4H7BrF3NO4S2 and a molecular weight of 334.14 g/mol. Its IUPAC name is 3-bromo-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 3-bromo-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 174191027 |
| Molecular Formula | C4H7BrF3NO4S2 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 3-bromo-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCBr)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H7BrF3NO4S2/c5-2-1-3-14(10,11)9-15(12,13)4(6,7)8/h9H,1-3H2 |
| InChIKey | XDVHBZRYUFLSLT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|