C9H20F3NO5S2Si — CID 153300698
5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)pentane-1-sulfonamide (PubChem CID 153300698) has the molecular formula C9H20F3NO5S2Si and a molecular weight of 371.48 g/mol. Its IUPAC name is 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)pentane-1-sulfonamide.
| Compound Name | 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 153300698 |
| Molecular Formula | C9H20F3NO5S2Si |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)pentane-1-sulfonamide |
| SMILES | CO[Si](C)(C)CCCCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H20F3NO5S2Si/c1-18-21(2,3)8-6-4-5-7-19(14,15)13-20(16,17)9(10,11)12/h13H,4-8H2,1-3H3 |
| InChIKey | RXJNSFATNCGVJK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|