C8H17F3NO5S2Si- — CID 153300674
4-[methoxy(dimethyl)silyl]butylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 153300674) has the molecular formula C8H17F3NO5S2Si- and a molecular weight of 356.44 g/mol. Its IUPAC name is 4-[methoxy(dimethyl)silyl]butylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 4-[methoxy(dimethyl)silyl]butylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 153300674 |
| Molecular Formula | C8H17F3NO5S2Si- |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 4-[methoxy(dimethyl)silyl]butylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CO[Si](C)(C)CCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H17F3NO5S2Si/c1-17-20(2,3)7-5-4-6-18(13,14)12-19(15,16)8(9,10)11/h4-7H2,1-3H3/q-1 |
| InChIKey | CMRKAJBWLNWBNR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|