C9H14F3N3O4S2 — CID 175784964
3-(3-ethylimidazol-1-ium-1-yl)propylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 175784964) has the molecular formula C9H14F3N3O4S2 and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-(3-ethylimidazol-1-ium-1-yl)propylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 3-(3-ethylimidazol-1-ium-1-yl)propylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 175784964 |
| Molecular Formula | C9H14F3N3O4S2 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-(3-ethylimidazol-1-ium-1-yl)propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCn1cc[n+](CCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H14F3N3O4S2/c1-2-14-5-6-15(8-14)4-3-7-20(16,17)13-21(18,19)9(10,11)12/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | RGAJAYKLGOSUCG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|