C10H16ClF6N3O4S2Si — CID 153323816
bis(trifluoromethylsulfonyl)azanide;chloro-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane (PubChem CID 153323816) has the molecular formula C10H16ClF6N3O4S2Si and a molecular weight of 483.92 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;chloro-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;chloro-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 153323816 |
| Molecular Formula | C10H16ClF6N3O4S2Si |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;chloro-[(3-ethylimidazol-1-ium-1-yl)methyl]-dimethylsilane |
| SMILES | CCn1cc[n+](C[Si](C)(C)Cl)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H16ClN2Si.C2F6NO4S2/c1-4-10-5-6-11(7-10)8-12(2,3)9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-7H,4,8H2,1-3H3;/q+1;-1 |
| InChIKey | NKCFJXZFXDJLGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|