C21H37F6N3O6S2 — CID 11353950
1,3-bis(heptoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 11353950) has the molecular formula C21H37F6N3O6S2 and a molecular weight of 605.66 g/mol. Its IUPAC name is 1,3-bis(heptoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | 1,3-bis(heptoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 11353950 |
| Molecular Formula | C21H37F6N3O6S2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 1,3-bis(heptoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | CCCCCCCOCn1cc[n+](COCCCCCCC)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H37N2O2.C2F6NO4S2/c1-3-5-7-9-11-15-22-18-20-13-14-21(17-20)19-23-16-12-10-8-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h13-14,17H,3-12,15-16,18-19H2,1-2H3;/q+1;-1 |
| InChIKey | KBWPCKHHKZASOF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|