C19H37N2O2+ — CID 101112370
1-(butoxymethyl)-3-(decoxymethyl)imidazol-3-ium (PubChem CID 101112370) has the molecular formula C19H37N2O2+ and a molecular weight of 325.52 g/mol. Its IUPAC name is 1-(butoxymethyl)-3-(decoxymethyl)imidazol-3-ium.
| Compound Name | 1-(butoxymethyl)-3-(decoxymethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 101112370 |
| Molecular Formula | C19H37N2O2+ |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 1-(butoxymethyl)-3-(decoxymethyl)imidazol-3-ium |
| SMILES | CCCCCCCCCCOC[n+]1ccn(COCCCC)c1 |
| InChI | InChI=1S/C19H37N2O2/c1-3-5-7-8-9-10-11-12-16-23-19-21-14-13-20(17-21)18-22-15-6-4-2/h13-14,17H,3-12,15-16,18-19H2,1-2H3/q+1 |
| InChIKey | MXJRXJRYVCWMRJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|