C23H26F6N3O4PS2 — CID 24766648
bis(trifluoromethylsulfonyl)azanide;2-(3-butylimidazol-3-ium-1-yl)ethyl-diphenylphosphane (PubChem CID 24766648) has the molecular formula C23H26F6N3O4PS2 and a molecular weight of 617.57 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-(3-butylimidazol-3-ium-1-yl)ethyl-diphenylphosphane.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-(3-butylimidazol-3-ium-1-yl)ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 24766648 |
| Molecular Formula | C23H26F6N3O4PS2 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-(3-butylimidazol-3-ium-1-yl)ethyl-diphenylphosphane |
| SMILES | CCCC[n+]1ccn(CCP(c2ccccc2)c2ccccc2)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H26N2P.C2F6NO4S2/c1-2-3-14-22-15-16-23(19-22)17-18-24(20-10-6-4-7-11-20)21-12-8-5-9-13-21;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-13,15-16,19H,2-3,14,17-18H2,1H3;/q+1;-1 |
| InChIKey | IMRXJVPUPOVOCG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|