C18H22ClF6N3O4S2 — CID 139253094
bis(trifluoromethylsulfonyl)azanide;1-(4-chlorophenyl)-3-heptylimidazol-3-ium (PubChem CID 139253094) has the molecular formula C18H22ClF6N3O4S2 and a molecular weight of 557.97 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-(4-chlorophenyl)-3-heptylimidazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-(4-chlorophenyl)-3-heptylimidazol-3-ium |
|---|---|
| PubChem CID | 139253094 |
| Molecular Formula | C18H22ClF6N3O4S2 |
| Molecular Weight | 557.97 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-(4-chlorophenyl)-3-heptylimidazol-3-ium |
| SMILES | CCCCCCC[n+]1ccn(-c2ccc(Cl)cc2)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H22ClN2.C2F6NO4S2/c1-2-3-4-5-6-11-18-12-13-19(14-18)16-9-7-15(17)8-10-16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-10,12-14H,2-6,11H2,1H3;/q+1;-1 |
| InChIKey | UYLRGZFDARREOF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.97 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|