C10H21F3N2O4S2 — CID 177489735
3-[butyl(dimethyl)azaniumyl]propylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 177489735) has the molecular formula C10H21F3N2O4S2 and a molecular weight of 354.42 g/mol. Its IUPAC name is 3-[butyl(dimethyl)azaniumyl]propylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 3-[butyl(dimethyl)azaniumyl]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 177489735 |
| Molecular Formula | C10H21F3N2O4S2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-[butyl(dimethyl)azaniumyl]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCCC[N+](C)(C)CCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O4S2/c1-4-5-7-15(2,3)8-6-9-20(16,17)14-21(18,19)10(11,12)13/h4-9H2,1-3H3 |
| InChIKey | NXFROWYZBCMWBK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|