C45H96F2N2O6S2 — CID 158618424
bis(didecyl(dimethyl)azanium);difluoromethanedisulfonate (PubChem CID 158618424) has the molecular formula C45H96F2N2O6S2 and a molecular weight of 863.40 g/mol. Its IUPAC name is bis(didecyl(dimethyl)azanium);difluoromethanedisulfonate.
| Compound Name | bis(didecyl(dimethyl)azanium);difluoromethanedisulfonate |
|---|---|
| PubChem CID | 158618424 |
| Molecular Formula | C45H96F2N2O6S2 |
| Molecular Weight | 863.40 g/mol |
| Exact Mass | 862.67 |
| IUPAC Name | bis(didecyl(dimethyl)azanium);difluoromethanedisulfonate |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)([O-])C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/2C22H48N.CH2F2O6S2/c2*1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;2-1(3,10(4,5)6)11(7,8)9/h2*5-22H2,1-4H3;(H,4,5,6)(H,7,8,9)/q2*+1;/p-2 |
| InChIKey | HXRKTXFTKRXFNB-UHFFFAOYSA-L |
| XLogP | 13.32 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.40 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|