C16H28F6O6SSi — CID 153308380
3,3,3-trifluoro-2-[9-[methoxy(dimethyl)silyl]nonanoyloxy]-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 153308380) has the molecular formula C16H28F6O6SSi and a molecular weight of 490.54 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[9-[methoxy(dimethyl)silyl]nonanoyloxy]-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[9-[methoxy(dimethyl)silyl]nonanoyloxy]-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 153308380 |
| Molecular Formula | C16H28F6O6SSi |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3,3,3-trifluoro-2-[9-[methoxy(dimethyl)silyl]nonanoyloxy]-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | CO[Si](C)(C)CCCCCCCCC(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H28F6O6SSi/c1-27-30(2,3)11-9-7-5-4-6-8-10-13(23)28-14(15(17,18)19,16(20,21)22)12-29(24,25)26/h4-12H2,1-3H3,(H,24,25,26) |
| InChIKey | QSZFGYYKLGTURW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|