C14H21F6O5S- — CID 140854784
2-decanoyloxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 140854784) has the molecular formula C14H21F6O5S- and a molecular weight of 415.37 g/mol. Its IUPAC name is 2-decanoyloxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 2-decanoyloxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140854784 |
| Molecular Formula | C14H21F6O5S- |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-decanoyloxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | CCCCCCCCCC(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H22F6O5S/c1-2-3-4-5-6-7-8-9-11(21)25-12(13(15,16)17,14(18,19)20)10-26(22,23)24/h2-10H2,1H3,(H,22,23,24)/p-1 |
| InChIKey | IORLCAWPZZQJFC-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|