C17H31F3O5S — CID 158236420
3,3,3-trifluoro-2-methyl-2-(11-methyldodecanoyloxy)propane-1-sulfonic acid (PubChem CID 158236420) has the molecular formula C17H31F3O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(11-methyldodecanoyloxy)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(11-methyldodecanoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 158236420 |
| Molecular Formula | C17H31F3O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(11-methyldodecanoyloxy)propane-1-sulfonic acid |
| SMILES | CC(C)CCCCCCCCCC(=O)OC(C)(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C17H31F3O5S/c1-14(2)11-9-7-5-4-6-8-10-12-15(21)25-16(3,17(18,19)20)13-26(22,23)24/h14H,4-13H2,1-3H3,(H,22,23,24) |
| InChIKey | DWSMPUVJYSZXHI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|