C10H15F3O7S — CID 165080654
3,3,3-trifluoro-2-methyl-2-[3-(oxiran-2-ylmethoxy)propanoyloxy]propane-1-sulfonic acid (PubChem CID 165080654) has the molecular formula C10H15F3O7S and a molecular weight of 336.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[3-(oxiran-2-ylmethoxy)propanoyloxy]propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[3-(oxiran-2-ylmethoxy)propanoyloxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 165080654 |
| Molecular Formula | C10H15F3O7S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[3-(oxiran-2-ylmethoxy)propanoyloxy]propane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)(OC(=O)CCOCC1CO1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O7S/c1-9(10(11,12)13,6-21(15,16)17)20-8(14)2-3-18-4-7-5-19-7/h7H,2-6H2,1H3,(H,15,16,17) |
| InChIKey | FVOQKFWOEMSNKC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|