C11H18F3NO5S — CID 167083292
2-methyl-6-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)hexanamide (PubChem CID 167083292) has the molecular formula C11H18F3NO5S and a molecular weight of 333.33 g/mol. Its IUPAC name is 2-methyl-6-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)hexanamide.
| Compound Name | 2-methyl-6-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)hexanamide |
|---|---|
| PubChem CID | 167083292 |
| Molecular Formula | C11H18F3NO5S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-methyl-6-(oxiran-2-ylmethoxy)-N-(trifluoromethylsulfonyl)hexanamide |
| SMILES | CC(CCCCOCC1CO1)C(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO5S/c1-8(4-2-3-5-19-6-9-7-20-9)10(16)15-21(17,18)11(12,13)14/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | CHLZUHGMIYURLC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|