C18H38O2S — CID 174333387
dimethyl-[3-(oxiran-2-ylmethoxy)propyl]-(5,6,6-trimethylheptyl)-λ4-sulfane (PubChem CID 174333387) has the molecular formula C18H38O2S and a molecular weight of 318.57 g/mol. Its IUPAC name is dimethyl-[3-(oxiran-2-ylmethoxy)propyl]-(5,6,6-trimethylheptyl)-λ4-sulfane.
| Compound Name | dimethyl-[3-(oxiran-2-ylmethoxy)propyl]-(5,6,6-trimethylheptyl)-λ4-sulfane |
|---|---|
| PubChem CID | 174333387 |
| Molecular Formula | C18H38O2S |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | dimethyl-[3-(oxiran-2-ylmethoxy)propyl]-(5,6,6-trimethylheptyl)-λ4-sulfane |
| SMILES | CC(CCCCS(C)(C)CCCOCC1CO1)C(C)(C)C |
| InChI | InChI=1S/C18H38O2S/c1-16(18(2,3)4)10-7-8-12-21(5,6)13-9-11-19-14-17-15-20-17/h16-17H,7-15H2,1-6H3 |
| InChIKey | SOTVOILETHQWTE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|