C23H46O4 — CID 152572245
2-[4-(1,1-dipropoxyethyl)dodecoxymethyl]oxirane (PubChem CID 152572245) has the molecular formula C23H46O4 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-[4-(1,1-dipropoxyethyl)dodecoxymethyl]oxirane.
| Compound Name | 2-[4-(1,1-dipropoxyethyl)dodecoxymethyl]oxirane |
|---|---|
| PubChem CID | 152572245 |
| Molecular Formula | C23H46O4 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 2-[4-(1,1-dipropoxyethyl)dodecoxymethyl]oxirane |
| SMILES | CCCCCCCCC(CCCOCC1CO1)C(C)(OCCC)OCCC |
| InChI | InChI=1S/C23H46O4/c1-5-8-9-10-11-12-14-21(15-13-18-24-19-22-20-25-22)23(4,26-16-6-2)27-17-7-3/h21-22H,5-20H2,1-4H3 |
| InChIKey | YRSMXKXKMCLNNB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|