About 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane
2-[5-(1,1-diethoxyethyl)tridecyl]oxirane (PubChem CID 151153134) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane.
Molecular Properties
| Compound Name | 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane |
| PubChem CID | 151153134 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane |
| SMILES | CCCCCCCCC(CCCCC1CO1)C(C)(OCC)OCC |
| InChI | InChI=1S/C21H42O3/c1-5-8-9-10-11-12-15-19(16-13-14-17-20-18-22-20)21(4,23-6-2)24-7-3/h19-20H,5-18H2,1-4H3 |
| InChIKey | MYQOXHRWZIJWER-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane?
The IUPAC name of 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane (CID 151153134) is 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane.
What is the SMILES notation for 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane?
The canonical SMILES for 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane is CCCCCCCCC(CCCCC1CO1)C(C)(OCC)OCC.
What is the InChIKey of 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane?
The InChIKey is MYQOXHRWZIJWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O3/c1-5-8-9-10-11-12-15-19(16-13-14-17-20-18-22-20)21(4,23-6-2)24-7-3/h19-20H,5-18H2,1-4H3.
What are the key properties of 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane?
2-[5-(1,1-diethoxyethyl)tridecyl]oxirane has a molecular weight of 342.56 g/mol, XLogP of 6.10, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,1-diethoxyethyl)tridecyl]oxirane is sourced from PubChem (CID 151153134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).