C11H20O4 — CID 164730265
3-(oxiran-2-ylmethoxy)propyl 2-methylbutanoate (PubChem CID 164730265) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)propyl 2-methylbutanoate.
| Compound Name | 3-(oxiran-2-ylmethoxy)propyl 2-methylbutanoate |
|---|---|
| PubChem CID | 164730265 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)propyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCOCC1CO1 |
| InChI | InChI=1S/C11H20O4/c1-3-9(2)11(12)14-6-4-5-13-7-10-8-15-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | ZSJMTOZIUMXHBU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|