C21H45NO5 — CID 157339114
methane;4-(oxiran-2-ylmethoxy)butyl 2-methylbutanoate;N,N,2-trimethylbutanamide (PubChem CID 157339114) has the molecular formula C21H45NO5 and a molecular weight of 391.59 g/mol. Its IUPAC name is methane;4-(oxiran-2-ylmethoxy)butyl 2-methylbutanoate;N,N,2-trimethylbutanamide.
| Compound Name | methane;4-(oxiran-2-ylmethoxy)butyl 2-methylbutanoate;N,N,2-trimethylbutanamide |
|---|---|
| PubChem CID | 157339114 |
| Molecular Formula | C21H45NO5 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | methane;4-(oxiran-2-ylmethoxy)butyl 2-methylbutanoate;N,N,2-trimethylbutanamide |
| SMILES | C.C.CCC(C)C(=O)N(C)C.CCC(C)C(=O)OCCCCOCC1CO1 |
| InChI | InChI=1S/C12H22O4.C7H15NO.2CH4/c1-3-10(2)12(13)15-7-5-4-6-14-8-11-9-16-11;1-5-6(2)7(9)8(3)4;;/h10-11H,3-9H2,1-2H3;6H,5H2,1-4H3;2*1H4 |
| InChIKey | BGEOEKBZGNUBPY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|