C14H18F6O7S — CID 134419298
3,3,3-trifluoro-2-(4-propanoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 134419298) has the molecular formula C14H18F6O7S and a molecular weight of 444.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-propanoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(4-propanoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 134419298 |
| Molecular Formula | C14H18F6O7S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-propanoyloxycyclohexanecarbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | CCC(=O)OC1CCC(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F6O7S/c1-2-10(21)26-9-5-3-8(4-6-9)11(22)27-12(13(15,16)17,14(18,19)20)7-28(23,24)25/h8-9H,2-7H2,1H3,(H,23,24,25) |
| InChIKey | QPSWZBFXELUIHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|