C12H14F6O7S — CID 59445698
2-[1,1,1,3,3,3-hexafluoro-2-(sulfomethyl)propan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 59445698) has the molecular formula C12H14F6O7S and a molecular weight of 416.29 g/mol. Its IUPAC name is 2-[1,1,1,3,3,3-hexafluoro-2-(sulfomethyl)propan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[1,1,1,3,3,3-hexafluoro-2-(sulfomethyl)propan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 59445698 |
| Molecular Formula | C12H14F6O7S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-[1,1,1,3,3,3-hexafluoro-2-(sulfomethyl)propan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O7S/c13-11(14,15)10(12(16,17)18,5-26(22,23)24)25-9(21)7-4-2-1-3-6(7)8(19)20/h6-7H,1-5H2,(H,19,20)(H,22,23,24) |
| InChIKey | IKRSSBQTTDQXCE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|