C11H17FO7S — CID 122692807
2-(2-fluoro-3-sulfopropoxy)carbonylcyclohexane-1-carboxylic acid (PubChem CID 122692807) has the molecular formula C11H17FO7S and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-(2-fluoro-3-sulfopropoxy)carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(2-fluoro-3-sulfopropoxy)carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122692807 |
| Molecular Formula | C11H17FO7S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(2-fluoro-3-sulfopropoxy)carbonylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OCC(F)CS(=O)(=O)O |
| InChI | InChI=1S/C11H17FO7S/c12-7(6-20(16,17)18)5-19-11(15)9-4-2-1-3-8(9)10(13)14/h7-9H,1-6H2,(H,13,14)(H,16,17,18) |
| InChIKey | MOJLNLUYTSNUSA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|