C8H12O4S — CID 150374950
2-sulfanyloxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 150374950) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-sulfanyloxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-sulfanyloxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 150374950 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-sulfanyloxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)OS |
| InChI | InChI=1S/C8H12O4S/c9-7(10)5-3-1-2-4-6(5)8(11)12-13/h5-6,13H,1-4H2,(H,9,10) |
| InChIKey | GYMMFYOOUFLROF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|