C24H32O10 — CID 155369817
2-[3-(2-carboxycyclohexanecarbonyl)oxycarbonylcyclohexanecarbonyl]oxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 155369817) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is 2-[3-(2-carboxycyclohexanecarbonyl)oxycarbonylcyclohexanecarbonyl]oxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-(2-carboxycyclohexanecarbonyl)oxycarbonylcyclohexanecarbonyl]oxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155369817 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-[3-(2-carboxycyclohexanecarbonyl)oxycarbonylcyclohexanecarbonyl]oxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | O=C(OC(=O)C1CCCCC1C(=O)O)C1CCCC(C(=O)OC(=O)C2CCCCC2C(=O)O)C1 |
| InChI | InChI=1S/C24H32O10/c25-19(26)15-8-1-3-10-17(15)23(31)33-21(29)13-6-5-7-14(12-13)22(30)34-24(32)18-11-4-2-9-16(18)20(27)28/h13-18H,1-12H2,(H,25,26)(H,27,28) |
| InChIKey | TZQCQWBOTFOKDI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|