C11H24F6N2O10S2Si — CID 168975375
bis(trifluoromethylsulfonyl)azanide;trimethoxy(3-trimethoxysilylpropyl)azanium (PubChem CID 168975375) has the molecular formula C11H24F6N2O10S2Si and a molecular weight of 550.53 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;trimethoxy(3-trimethoxysilylpropyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;trimethoxy(3-trimethoxysilylpropyl)azanium |
|---|---|
| PubChem CID | 168975375 |
| Molecular Formula | C11H24F6N2O10S2Si |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;trimethoxy(3-trimethoxysilylpropyl)azanium |
| SMILES | CO[N+](CCC[Si](OC)(OC)OC)(OC)OC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H24NO6Si.C2F6NO4S2/c1-11-10(12-2,13-3)8-7-9-17(14-4,15-5)16-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-9H2,1-6H3;/q+1;-1 |
| InChIKey | NLSCGUPXPJUTHL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 137.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|