C6H10F3NO6S2 — CID 102490574
3-(oxiran-2-yloxy)-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 102490574) has the molecular formula C6H10F3NO6S2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-(oxiran-2-yloxy)-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 3-(oxiran-2-yloxy)-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 102490574 |
| Molecular Formula | C6H10F3NO6S2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3-(oxiran-2-yloxy)-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCOC1CO1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO6S2/c7-6(8,9)18(13,14)10-17(11,12)3-1-2-15-5-4-16-5/h5,10H,1-4H2 |
| InChIKey | ZFDFZXJWGRNKEP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|