C9H14F3NO7S2 — CID 167078247
[3-(oxiran-2-ylmethoxy)cyclopentyl] N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 167078247) has the molecular formula C9H14F3NO7S2 and a molecular weight of 369.34 g/mol. Its IUPAC name is [3-(oxiran-2-ylmethoxy)cyclopentyl] N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | [3-(oxiran-2-ylmethoxy)cyclopentyl] N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 167078247 |
| Molecular Formula | C9H14F3NO7S2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | [3-(oxiran-2-ylmethoxy)cyclopentyl] N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)OC1CCC(OCC2CO2)C1 |
| InChI | InChI=1S/C9H14F3NO7S2/c10-9(11,12)21(14,15)13-22(16,17)20-7-2-1-6(3-7)18-4-8-5-19-8/h6-8,13H,1-5H2 |
| InChIKey | OIKNQNHCTWFKCI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|