C15H22F2O7S — CID 164777696
1,1-difluoro-2-[5-(oxiran-2-ylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonyl]oxyethanesulfonic acid (PubChem CID 164777696) has the molecular formula C15H22F2O7S and a molecular weight of 384.40 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-(oxiran-2-ylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[5-(oxiran-2-ylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 164777696 |
| Molecular Formula | C15H22F2O7S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1,1-difluoro-2-[5-(oxiran-2-ylmethoxy)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-2-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C1CC2CCC(OCC3CO3)CC2C1 |
| InChI | InChI=1S/C15H22F2O7S/c16-15(17,25(19,20)21)8-24-14(18)11-3-9-1-2-12(5-10(9)4-11)22-6-13-7-23-13/h9-13H,1-8H2,(H,19,20,21) |
| InChIKey | PVWRKNICEYLEIT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|