C9H15F2NaO5S — CID 173100504
sodium;2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid;hydride (PubChem CID 173100504) has the molecular formula C9H15F2NaO5S and a molecular weight of 296.27 g/mol. Its IUPAC name is sodium;2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid;hydride.
| Compound Name | sodium;2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid;hydride |
|---|---|
| PubChem CID | 173100504 |
| Molecular Formula | C9H15F2NaO5S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | sodium;2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid;hydride |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C1CCCCC1.[H-].[Na+] |
| InChI | InChI=1S/C9H14F2O5S.Na.H/c10-9(11,17(13,14)15)6-16-8(12)7-4-2-1-3-5-7;;/h7H,1-6H2,(H,13,14,15);;/q;+1;-1 |
| InChIKey | CAMCLUFDVZFYPX-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|