C10H15F3O5S — CID 122695531
3-(cyclohexanecarbonyloxy)-1,1,2-trifluoropropane-1-sulfonic acid (PubChem CID 122695531) has the molecular formula C10H15F3O5S and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-(cyclohexanecarbonyloxy)-1,1,2-trifluoropropane-1-sulfonic acid.
| Compound Name | 3-(cyclohexanecarbonyloxy)-1,1,2-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 122695531 |
| Molecular Formula | C10H15F3O5S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-(cyclohexanecarbonyloxy)-1,1,2-trifluoropropane-1-sulfonic acid |
| SMILES | O=C(OCC(F)C(F)(F)S(=O)(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C10H15F3O5S/c11-8(10(12,13)19(15,16)17)6-18-9(14)7-4-2-1-3-5-7/h7-8H,1-6H2,(H,15,16,17) |
| InChIKey | WLIGUKMIJBKVMQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|