C9H15AlF2O5S — CID 146922093
2-alumanyl-2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid (PubChem CID 146922093) has the molecular formula C9H15AlF2O5S and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-alumanyl-2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-alumanyl-2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 146922093 |
| Molecular Formula | C9H15AlF2O5S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-alumanyl-2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OC([AlH2])C(F)(F)S(=O)(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C9H13F2O5S.Al.2H/c10-9(11,17(13,14)15)6-16-8(12)7-4-2-1-3-5-7;;;/h6-7H,1-5H2,(H,13,14,15);;; |
| InChIKey | ADJPMVJFOPWYQX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|