2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid

C4H7AlF2O5S — CID 162546913

IUPAC2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid
SMILESCC(=O)OC([AlH2])C(F)(F)S(=O)(=O)O
InChIInChI=1S/C4H5F2O5S.Al.2H/c1-3(7)11-2-4(5,6)12(8,9)10;;;/h2H,1H3,(H,8,9,10);;;
InChIKeyPFXXWVZQYGXFIA-UHFFFAOYSA-N
MW232.14 g/mol
LogP-1.01
Rot. Bonds3

About 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid

2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid (PubChem CID 162546913) has the molecular formula C4H7AlF2O5S and a molecular weight of 232.14 g/mol. Its IUPAC name is 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid.

Molecular Properties

Compound Name2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid
PubChem CID162546913
Molecular FormulaC4H7AlF2O5S
Molecular Weight232.14 g/mol
Exact Mass231.98
IUPAC Name2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid
SMILESCC(=O)OC([AlH2])C(F)(F)S(=O)(=O)O
InChIInChI=1S/C4H5F2O5S.Al.2H/c1-3(7)11-2-4(5,6)12(8,9)10;;;/h2H,1H3,(H,8,9,10);;;
InChIKeyPFXXWVZQYGXFIA-UHFFFAOYSA-N
XLogP-1.01
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.14
LogP ≤ 5-1.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid (CID 162546913) is 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid is CC(=O)OC([AlH2])C(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid?
The InChIKey is PFXXWVZQYGXFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F2O5S.Al.2H/c1-3(7)11-2-4(5,6)12(8,9)10;;;/h2H,1H3,(H,8,9,10);;;.
What are the key properties of 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid?
2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid has a molecular weight of 232.14 g/mol, XLogP of -1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 162546913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).