C4H7AlF2O5S — CID 162546913
2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid (PubChem CID 162546913) has the molecular formula C4H7AlF2O5S and a molecular weight of 232.14 g/mol. Its IUPAC name is 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 162546913 |
| Molecular Formula | C4H7AlF2O5S |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 2-acetyloxy-2-alumanyl-1,1-difluoroethanesulfonic acid |
| SMILES | CC(=O)OC([AlH2])C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C4H5F2O5S.Al.2H/c1-3(7)11-2-4(5,6)12(8,9)10;;;/h2H,1H3,(H,8,9,10);;; |
| InChIKey | PFXXWVZQYGXFIA-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|