C6H9F3O5S — CID 177115328
3-acetyloxy-1,1,1-trifluorobutane-2-sulfonic acid (PubChem CID 177115328) has the molecular formula C6H9F3O5S and a molecular weight of 250.19 g/mol. Its IUPAC name is 3-acetyloxy-1,1,1-trifluorobutane-2-sulfonic acid.
| Compound Name | 3-acetyloxy-1,1,1-trifluorobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 177115328 |
| Molecular Formula | C6H9F3O5S |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-acetyloxy-1,1,1-trifluorobutane-2-sulfonic acid |
| SMILES | CC(=O)OC(C)C(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C6H9F3O5S/c1-3(14-4(2)10)5(6(7,8)9)15(11,12)13/h3,5H,1-2H3,(H,11,12,13) |
| InChIKey | FITXQVYIBCUKED-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|