2-acetyloxy-1,1-difluorobutane-1-sulfonic acid

C6H10F2O5S — CID 129070755

IUPAC2-acetyloxy-1,1-difluorobutane-1-sulfonic acid
SMILESCCC(OC(C)=O)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C6H10F2O5S/c1-3-5(13-4(2)9)6(7,8)14(10,11)12/h5H,3H2,1-2H3,(H,10,11,12)
InChIKeyXTPVFBFJVBDFQR-UHFFFAOYSA-N
MW232.20 g/mol
LogP0.81
Rot. Bonds4

About 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid

2-acetyloxy-1,1-difluorobutane-1-sulfonic acid (PubChem CID 129070755) has the molecular formula C6H10F2O5S and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid.

Molecular Properties

Compound Name2-acetyloxy-1,1-difluorobutane-1-sulfonic acid
PubChem CID129070755
Molecular FormulaC6H10F2O5S
Molecular Weight232.20 g/mol
Exact Mass232.02
IUPAC Name2-acetyloxy-1,1-difluorobutane-1-sulfonic acid
SMILESCCC(OC(C)=O)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C6H10F2O5S/c1-3-5(13-4(2)9)6(7,8)14(10,11)12/h5H,3H2,1-2H3,(H,10,11,12)
InChIKeyXTPVFBFJVBDFQR-UHFFFAOYSA-N
XLogP0.81
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.20
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid?
The IUPAC name of 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid (CID 129070755) is 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid.
What is the SMILES notation for 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid?
The canonical SMILES for 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid is CCC(OC(C)=O)C(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid?
The InChIKey is XTPVFBFJVBDFQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2O5S/c1-3-5(13-4(2)9)6(7,8)14(10,11)12/h5H,3H2,1-2H3,(H,10,11,12).
What are the key properties of 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid?
2-acetyloxy-1,1-difluorobutane-1-sulfonic acid has a molecular weight of 232.20 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid is sourced from PubChem (CID 129070755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).