C6H10F2O5S — CID 129070755
2-acetyloxy-1,1-difluorobutane-1-sulfonic acid (PubChem CID 129070755) has the molecular formula C6H10F2O5S and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid.
| Compound Name | 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070755 |
| Molecular Formula | C6H10F2O5S |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-acetyloxy-1,1-difluorobutane-1-sulfonic acid |
| SMILES | CCC(OC(C)=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C6H10F2O5S/c1-3-5(13-4(2)9)6(7,8)14(10,11)12/h5H,3H2,1-2H3,(H,10,11,12) |
| InChIKey | XTPVFBFJVBDFQR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|