C5H4BrF3O3 — CID 151246638
(3-bromo-1,1,1-trifluoro-3-oxopropan-2-yl) acetate (PubChem CID 151246638) has the molecular formula C5H4BrF3O3 and a molecular weight of 248.98 g/mol. Its IUPAC name is (3-bromo-1,1,1-trifluoro-3-oxopropan-2-yl) acetate.
| Compound Name | (3-bromo-1,1,1-trifluoro-3-oxopropan-2-yl) acetate |
|---|---|
| PubChem CID | 151246638 |
| Molecular Formula | C5H4BrF3O3 |
| Molecular Weight | 248.98 g/mol |
| Exact Mass | 247.93 |
| IUPAC Name | (3-bromo-1,1,1-trifluoro-3-oxopropan-2-yl) acetate |
| SMILES | CC(=O)OC(C(=O)Br)C(F)(F)F |
| InChI | InChI=1S/C5H4BrF3O3/c1-2(10)12-3(4(6)11)5(7,8)9/h3H,1H3 |
| InChIKey | NRLFYZBZCAFNCO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.98 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|