C14H21AlF2O5S — CID 147610707
2-alumanyl-1,1-difluoro-2-(5-methyltricyclo[5.2.1.03,9]decane-5-carbonyl)oxyethanesulfonic acid (PubChem CID 147610707) has the molecular formula C14H21AlF2O5S and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-alumanyl-1,1-difluoro-2-(5-methyltricyclo[5.2.1.03,9]decane-5-carbonyl)oxyethanesulfonic acid.
| Compound Name | 2-alumanyl-1,1-difluoro-2-(5-methyltricyclo[5.2.1.03,9]decane-5-carbonyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 147610707 |
| Molecular Formula | C14H21AlF2O5S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-alumanyl-1,1-difluoro-2-(5-methyltricyclo[5.2.1.03,9]decane-5-carbonyl)oxyethanesulfonic acid |
| SMILES | CC1(C(=O)OC([AlH2])C(F)(F)S(=O)(=O)O)CC2CC3CC(C1)C3C2 |
| InChI | InChI=1S/C14H19F2O5S.Al.2H/c1-13(12(17)21-7-14(15,16)22(18,19)20)5-8-2-9-4-10(6-13)11(9)3-8;;;/h7-11H,2-6H2,1H3,(H,18,19,20);;; |
| InChIKey | GBYFKZSVQOETKO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|