About 5,5-dimethyltricyclo[5.2.1.03,9]decane
5,5-dimethyltricyclo[5.2.1.03,9]decane (PubChem CID 123402715) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 5,5-dimethyltricyclo[5.2.1.03,9]decane.
Molecular Properties
| Compound Name | 5,5-dimethyltricyclo[5.2.1.03,9]decane |
| PubChem CID | 123402715 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5,5-dimethyltricyclo[5.2.1.03,9]decane |
| SMILES | CC1(C)CC2CC3CC(C1)C3C2 |
| InChI | InChI=1S/C12H20/c1-12(2)6-8-3-9-5-10(7-12)11(9)4-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | LBGAVKKRUGOITE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,5-dimethyltricyclo[5.2.1.03,9]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyltricyclo[5.2.1.03,9]decane?
The IUPAC name of 5,5-dimethyltricyclo[5.2.1.03,9]decane (CID 123402715) is 5,5-dimethyltricyclo[5.2.1.03,9]decane.
What is the SMILES notation for 5,5-dimethyltricyclo[5.2.1.03,9]decane?
The canonical SMILES for 5,5-dimethyltricyclo[5.2.1.03,9]decane is CC1(C)CC2CC3CC(C1)C3C2.
What is the InChIKey of 5,5-dimethyltricyclo[5.2.1.03,9]decane?
The InChIKey is LBGAVKKRUGOITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-12(2)6-8-3-9-5-10(7-12)11(9)4-8/h8-11H,3-7H2,1-2H3.
What are the key properties of 5,5-dimethyltricyclo[5.2.1.03,9]decane?
5,5-dimethyltricyclo[5.2.1.03,9]decane has a molecular weight of 164.29 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyltricyclo[5.2.1.03,9]decane is sourced from PubChem (CID 123402715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).