C12H20 — CID 123402715
5,5-dimethyltricyclo[5.2.1.03,9]decane (PubChem CID 123402715) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 5,5-dimethyltricyclo[5.2.1.03,9]decane.
| Compound Name | 5,5-dimethyltricyclo[5.2.1.03,9]decane |
|---|---|
| PubChem CID | 123402715 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5,5-dimethyltricyclo[5.2.1.03,9]decane |
| SMILES | CC1(C)CC2CC3CC(C1)C3C2 |
| InChI | InChI=1S/C12H20/c1-12(2)6-8-3-9-5-10(7-12)11(9)4-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | LBGAVKKRUGOITE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |