C18H30 — CID 123139653
2,2-dimethyl-3,3a,4,4a,4b,5,6,7,8,8a,9,9a,10,10a-tetradecahydro-1H-cyclopenta[b]fluorene (PubChem CID 123139653) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2,2-dimethyl-3,3a,4,4a,4b,5,6,7,8,8a,9,9a,10,10a-tetradecahydro-1H-cyclopenta[b]fluorene.
| Compound Name | 2,2-dimethyl-3,3a,4,4a,4b,5,6,7,8,8a,9,9a,10,10a-tetradecahydro-1H-cyclopenta[b]fluorene |
|---|---|
| PubChem CID | 123139653 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 2,2-dimethyl-3,3a,4,4a,4b,5,6,7,8,8a,9,9a,10,10a-tetradecahydro-1H-cyclopenta[b]fluorene |
| SMILES | CC1(C)CC2CC3CC4CCCCC4C3CC2C1 |
| InChI | InChI=1S/C18H30/c1-18(2)10-14-8-13-7-12-5-3-4-6-16(12)17(13)9-15(14)11-18/h12-17H,3-11H2,1-2H3 |
| InChIKey | SXTHDELJVZFWLP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |