C16H29Cl — CID 143318730
9-chloro-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene;ethane (PubChem CID 143318730) has the molecular formula C16H29Cl and a molecular weight of 256.86 g/mol. Its IUPAC name is 9-chloro-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene;ethane.
| Compound Name | 9-chloro-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene;ethane |
|---|---|
| PubChem CID | 143318730 |
| Molecular Formula | C16H29Cl |
| Molecular Weight | 256.86 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 9-chloro-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene;ethane |
| SMILES | CC.ClC1C2CCCCC2CC2CCCCC21 |
| InChI | InChI=1S/C14H23Cl.C2H6/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;1-2/h10-14H,1-9H2;1-2H3 |
| InChIKey | ULKSGODJGKBQAM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.86 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|