C10H14Cl4 — CID 57287780
1,2,3,4-tetrachloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 57287780) has the molecular formula C10H14Cl4 and a molecular weight of 276.03 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1,2,3,4-tetrachloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 57287780 |
| Molecular Formula | C10H14Cl4 |
| Molecular Weight | 276.03 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1,2,3,4-tetrachloro-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | ClC1C(Cl)C(Cl)C2CCCCC2C1Cl |
| InChI | InChI=1S/C10H14Cl4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h5-10H,1-4H2 |
| InChIKey | RIDMCUJNCSQLAC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|