C8H12Cl2S — CID 130884921
(1S,6R,7S,8R)-7,8-dichloro-9-thiabicyclo[4.2.1]nonane (PubChem CID 130884921) has the molecular formula C8H12Cl2S and a molecular weight of 211.16 g/mol. Its IUPAC name is (1S,6R,7S,8R)-7,8-dichloro-9-thiabicyclo[4.2.1]nonane.
| Compound Name | (1S,6R,7S,8R)-7,8-dichloro-9-thiabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 130884921 |
| Molecular Formula | C8H12Cl2S |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | (1S,6R,7S,8R)-7,8-dichloro-9-thiabicyclo[4.2.1]nonane |
| SMILES | Cl[C@@H]1[C@H](Cl)[C@@H]2CCCC[C@H]1S2 |
| InChI | InChI=1S/C8H12Cl2S/c9-7-5-3-1-2-4-6(11-5)8(7)10/h5-8H,1-4H2/t5-,6+,7+,8- |
| InChIKey | SDXOVOPMKQQVDQ-SOSBWXJGSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|