About cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane
cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane (PubChem CID 161010620) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane |
| PubChem CID | 161010620 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane |
| SMILES | C1=CCCC=C1.C1CCC2SC2C1 |
| InChI | InChI=1S/C6H10S.C6H8/c1-2-4-6-5(3-1)7-6;1-2-4-6-5-3-1/h5-6H,1-4H2;1-4H,5-6H2 |
| InChIKey | TXBRLPCLUXYAEW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane?
The IUPAC name of cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane (CID 161010620) is cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane.
What is the SMILES notation for cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane?
The canonical SMILES for cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane is C1=CCCC=C1.C1CCC2SC2C1.
What is the InChIKey of cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane?
The InChIKey is TXBRLPCLUXYAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10S.C6H8/c1-2-4-6-5(3-1)7-6;1-2-4-6-5-3-1/h5-6H,1-4H2;1-4H,5-6H2.
What are the key properties of cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane?
cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane has a molecular weight of 194.34 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-diene;7-thiabicyclo[4.1.0]heptane is sourced from PubChem (CID 161010620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).