C9H14S3 — CID 87706700
2,6-bis(thiiran-2-yl)thiane (PubChem CID 87706700) has the molecular formula C9H14S3 and a molecular weight of 218.41 g/mol. Its IUPAC name is 2,6-bis(thiiran-2-yl)thiane.
| Compound Name | 2,6-bis(thiiran-2-yl)thiane |
|---|---|
| PubChem CID | 87706700 |
| Molecular Formula | C9H14S3 |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2,6-bis(thiiran-2-yl)thiane |
| SMILES | C1CC(C2CS2)SC(C2CS2)C1 |
| InChI | InChI=1S/C9H14S3/c1-2-6(8-4-10-8)12-7(3-1)9-5-11-9/h6-9H,1-5H2 |
| InChIKey | OWNZXQRUPLGWLT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|