C8H15NS — CID 67386609
3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[d][1,3]thiazole (PubChem CID 67386609) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[d][1,3]thiazole.
| Compound Name | 3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 67386609 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[d][1,3]thiazole |
| SMILES | C1CCC2NCSC2CC1 |
| InChI | InChI=1S/C8H15NS/c1-2-4-7-8(5-3-1)10-6-9-7/h7-9H,1-6H2 |
| InChIKey | STLTWDVTWDGSRG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |