C12H21NS — CID 7614083
(4aR,5aS,9aS,10aR)-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine (PubChem CID 7614083) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (4aR,5aS,9aS,10aR)-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine.
| Compound Name | (4aR,5aS,9aS,10aR)-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
|---|---|
| PubChem CID | 7614083 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (4aR,5aS,9aS,10aR)-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
| SMILES | C1CC[C@@H]2S[C@@H]3CCCC[C@H]3N[C@H]2C1 |
| InChI | InChI=1S/C12H21NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h9-13H,1-8H2/t9-,10+,11-,12+ |
| InChIKey | MGTISLRHMWCSLR-BKUVIOGVSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |