C13H24N2S — CID 24870181
2-(1-methylpiperidin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole (PubChem CID 24870181) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-(1-methylpiperidin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole.
| Compound Name | 2-(1-methylpiperidin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 24870181 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(1-methylpiperidin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole |
| SMILES | CN1CCCCC1C1NC2CCCCC2S1 |
| InChI | InChI=1S/C13H24N2S/c1-15-9-5-4-7-11(15)13-14-10-6-2-3-8-12(10)16-13/h10-14H,2-9H2,1H3 |
| InChIKey | IJQKTCSNCTTWFY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |